About methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+)
methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) (PubChem CID 168819349) has the molecular formula C36H34NO2Ti
and a molecular weight of 560.54 g/mol. Its IUPAC name is methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+).
Molecular Properties
| Compound Name | methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) |
| PubChem CID | 168819349 |
| Molecular Formula | C36H34NO2Ti |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) |
| SMILES | Oc1ccccc1C1=N[C@H](c2ccccc2)CO1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Ti+3] |
| InChI | InChI=1S/C15H13NO2.3C7H7.Ti/c17-14-9-5-4-8-12(14)15-16-13(10-18-15)11-6-2-1-3-7-11;3*1-7-5-3-2-4-6-7;/h1-9,13,17H,10H2;3*2-6H,1H2;/q;3*-1;+3/t13-;;;;/m0..../s1 |
| InChIKey | NUZOILBIKDVVOY-AHJYMZSGSA-N |
| XLogP | 8.51 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+)?
The IUPAC name of methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) (CID 168819349) is methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+).
What is the SMILES notation for methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+)?
The canonical SMILES for methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) is Oc1ccccc1C1=N[C@H](c2ccccc2)CO1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Ti+3].
What is the InChIKey of methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+)?
The InChIKey is NUZOILBIKDVVOY-AHJYMZSGSA-N. The full InChI is InChI=1S/C15H13NO2.3C7H7.Ti/c17-14-9-5-4-8-12(14)15-16-13(10-18-15)11-6-2-1-3-7-11;3*1-7-5-3-2-4-6-7;/h1-9,13,17H,10H2;3*2-6H,1H2;/q;3*-1;+3/t13-;;;;/m0..../s1.
What are the key properties of methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+)?
methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) has a molecular weight of 560.54 g/mol, XLogP of 8.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanidylbenzene;2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol;titanium(3+) is sourced from PubChem (CID 168819349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).