About N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine
N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine (PubChem CID 168819910) has the molecular formula C18H33N3
and a molecular weight of 291.48 g/mol. Its IUPAC name is N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine.
Molecular Properties
| Compound Name | N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine |
| PubChem CID | 168819910 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine |
| SMILES | CCC/C=C/C=C/CCCN1CCN(C)/C1=N/C(C)(C)C |
| InChI | InChI=1S/C18H33N3/c1-6-7-8-9-10-11-12-13-14-21-16-15-20(5)17(21)19-18(2,3)4/h8-11H,6-7,12-16H2,1-5H3/b9-8+,11-10+,19-17- |
| InChIKey | OGZKVLDAMVPMDA-RXDPAWGVSA-N |
| XLogP | 4.08 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine?
The IUPAC name of N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine (CID 168819910) is N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine.
What is the SMILES notation for N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine?
The canonical SMILES for N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine is CCC/C=C/C=C/CCCN1CCN(C)/C1=N/C(C)(C)C.
What is the InChIKey of N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine?
The InChIKey is OGZKVLDAMVPMDA-RXDPAWGVSA-N. The full InChI is InChI=1S/C18H33N3/c1-6-7-8-9-10-11-12-13-14-21-16-15-20(5)17(21)19-18(2,3)4/h8-11H,6-7,12-16H2,1-5H3/b9-8+,11-10+,19-17-.
What are the key properties of N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine?
N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine has a molecular weight of 291.48 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-3-methylimidazolidin-2-imine is sourced from PubChem (CID 168819910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).