C18H33N3 — CID 168819926
N-tert-butyl-1-[(4Z,7Z)-deca-4,7-dienyl]-3-methylimidazolidin-2-imine (PubChem CID 168819926) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N-tert-butyl-1-[(4Z,7Z)-deca-4,7-dienyl]-3-methylimidazolidin-2-imine.
| Compound Name | N-tert-butyl-1-[(4Z,7Z)-deca-4,7-dienyl]-3-methylimidazolidin-2-imine |
|---|---|
| PubChem CID | 168819926 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N-tert-butyl-1-[(4Z,7Z)-deca-4,7-dienyl]-3-methylimidazolidin-2-imine |
| SMILES | CC/C=C\C/C=C\CCCN1CCN(C)/C1=N/C(C)(C)C |
| InChI | InChI=1S/C18H33N3/c1-6-7-8-9-10-11-12-13-14-21-16-15-20(5)17(21)19-18(2,3)4/h7-8,10-11H,6,9,12-16H2,1-5H3/b8-7-,11-10-,19-17- |
| InChIKey | SNJBSNFBUYXFCA-ZNNOZSQBSA-N |
| XLogP | 4.08 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|