About N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine
N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine (PubChem CID 168819947) has the molecular formula C17H31N3
and a molecular weight of 277.46 g/mol. Its IUPAC name is N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine.
Molecular Properties
| Compound Name | N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine |
| PubChem CID | 168819947 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine |
| SMILES | CC/C=C\CN1CCN(C/C=C\CC)C1=NC(C)(C)C |
| InChI | InChI=1S/C17H31N3/c1-6-8-10-12-19-14-15-20(13-11-9-7-2)16(19)18-17(3,4)5/h8-11H,6-7,12-15H2,1-5H3/b10-8-,11-9- |
| InChIKey | CBQHBTPGJUVSTN-WGEIWTTOSA-N |
| XLogP | 3.69 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine?
The IUPAC name of N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine (CID 168819947) is N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine.
What is the SMILES notation for N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine?
The canonical SMILES for N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine is CC/C=C\CN1CCN(C/C=C\CC)C1=NC(C)(C)C.
What is the InChIKey of N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine?
The InChIKey is CBQHBTPGJUVSTN-WGEIWTTOSA-N. The full InChI is InChI=1S/C17H31N3/c1-6-8-10-12-19-14-15-20(13-11-9-7-2)16(19)18-17(3,4)5/h8-11H,6-7,12-15H2,1-5H3/b10-8-,11-9-.
What are the key properties of N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine?
N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine has a molecular weight of 277.46 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1,3-bis[(Z)-pent-2-enyl]imidazolidin-2-imine is sourced from PubChem (CID 168819947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).