C17H31N3 — CID 168820146
N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-4,5-dihydroimidazol-2-amine (PubChem CID 168820146) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 168820146 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N-tert-butyl-1-[(4E,6E)-deca-4,6-dienyl]-4,5-dihydroimidazol-2-amine |
| SMILES | CCC/C=C/C=C/CCCN1CCN=C1NC(C)(C)C |
| InChI | InChI=1S/C17H31N3/c1-5-6-7-8-9-10-11-12-14-20-15-13-18-16(20)19-17(2,3)4/h7-10H,5-6,11-15H2,1-4H3,(H,18,19)/b8-7+,10-9+ |
| InChIKey | BZKVWDBTMNPYJI-XBLVEGMJSA-N |
| XLogP | 3.74 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|