About 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane
6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane (PubChem CID 168820419) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane |
| PubChem CID | 168820419 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane |
| SMILES | CC1CC2(CN(C)C2)CN1C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-10-6-12(7-13(5)8-12)9-14(10)11(2,3)4/h10H,6-9H2,1-5H3 |
| InChIKey | LOAJGROIWGQQOS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane?
The IUPAC name of 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane (CID 168820419) is 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane.
What is the SMILES notation for 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane?
The canonical SMILES for 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane is CC1CC2(CN(C)C2)CN1C(C)(C)C.
What is the InChIKey of 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane?
The InChIKey is LOAJGROIWGQQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-10-6-12(7-13(5)8-12)9-14(10)11(2,3)4/h10H,6-9H2,1-5H3.
What are the key properties of 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane?
6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane has a molecular weight of 196.34 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,7-dimethyl-2,6-diazaspiro[3.4]octane is sourced from PubChem (CID 168820419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).