About 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol
2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol (PubChem CID 168821030) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol |
| PubChem CID | 168821030 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol |
| SMILES | CN(CCO)[C@@H]1CN(C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C13H28N2O/c1-12(2,3)15-10-11(9-13(15,4)5)14(6)7-8-16/h11,16H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | UPBVNJLZPYWVQQ-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol?
The IUPAC name of 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol (CID 168821030) is 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol.
What is the SMILES notation for 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol?
The canonical SMILES for 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol is CN(CCO)[C@@H]1CN(C(C)(C)C)C(C)(C)C1.
What is the InChIKey of 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol?
The InChIKey is UPBVNJLZPYWVQQ-NSHDSACASA-N. The full InChI is InChI=1S/C13H28N2O/c1-12(2,3)15-10-11(9-13(15,4)5)14(6)7-8-16/h11,16H,7-10H2,1-6H3/t11-/m0/s1.
What are the key properties of 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol?
2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol has a molecular weight of 228.38 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S)-1-tert-butyl-5,5-dimethylpyrrolidin-3-yl]-methylamino]ethanol is sourced from PubChem (CID 168821030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).