C22H24ClFN4O5 — CID 168821124
tert-butyl (11R)-4-amino-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate (PubChem CID 168821124) has the molecular formula C22H24ClFN4O5 and a molecular weight of 478.91 g/mol. Its IUPAC name is tert-butyl (11R)-4-amino-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate.
| Compound Name | tert-butyl (11R)-4-amino-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 168821124 |
| Molecular Formula | C22H24ClFN4O5 |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | tert-butyl (11R)-4-amino-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-2-oxo-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=O)c3c(N)nc(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C22H24ClFN4O5/c1-22(2,3)33-21(31)27-7-8-28-11(9-27)10-32-18-15(20(28)30)19(25)26-17(16(18)23)14-12(24)5-4-6-13(14)29/h4-6,11,29H,7-10H2,1-3H3,(H2,25,26)/t11-/m1/s1 |
| InChIKey | LMRDTQDPAIYXFN-LLVKDONJSA-N |
| XLogP | 3.28 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |