About 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile
4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile (PubChem CID 168821657) has the molecular formula C21H12N4
and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 168821657 |
| Molecular Formula | C21H12N4 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(C#N)cc1-c1cc(-c2ccccc2)c(C)cn1 |
| InChI | InChI=1S/C21H12N4/c1-14-13-25-21(10-18(14)15-6-4-3-5-7-15)19-8-16(11-22)17(12-23)9-20(19)24-2/h3-10,13H,1H3 |
| InChIKey | QSZMJKOLACKECD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile (CID 168821657) is 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile is [C-]#[N+]c1cc(C#N)c(C#N)cc1-c1cc(-c2ccccc2)c(C)cn1.
What is the InChIKey of 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile?
The InChIKey is QSZMJKOLACKECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N4/c1-14-13-25-21(10-18(14)15-6-4-3-5-7-15)19-8-16(11-22)17(12-23)9-20(19)24-2/h3-10,13H,1H3.
What are the key properties of 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile?
4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile has a molecular weight of 320.36 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-5-(5-methyl-4-phenyl-2-pyridinyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 168821657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).