C28H30F3N5O2 — CID 168822483
1-[2-methyl-4-[[3-[5-(trifluoromethyl)-2H-pyrrol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]decane-1,7-dione (PubChem CID 168822483) has the molecular formula C28H30F3N5O2 and a molecular weight of 525.58 g/mol. Its IUPAC name is 1-[2-methyl-4-[[3-[5-(trifluoromethyl)-2H-pyrrol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]decane-1,7-dione.
| Compound Name | 1-[2-methyl-4-[[3-[5-(trifluoromethyl)-2H-pyrrol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]decane-1,7-dione |
|---|---|
| PubChem CID | 168822483 |
| Molecular Formula | C28H30F3N5O2 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 1-[2-methyl-4-[[3-[5-(trifluoromethyl)-2H-pyrrol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]decane-1,7-dione |
| SMILES | CCCC(=O)CCCCCC(=O)c1ccc(Nc2nccn3c(C4=CCN=C4C(F)(F)F)cnc23)cc1C |
| InChI | InChI=1S/C28H30F3N5O2/c1-3-7-20(37)8-5-4-6-9-24(38)21-11-10-19(16-18(21)2)35-26-27-34-17-23(36(27)15-14-33-26)22-12-13-32-25(22)28(29,30)31/h10-12,14-17H,3-9,13H2,1-2H3,(H,33,35) |
| InChIKey | JNQXWSDUDIHSOV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|