About deuterio-(3,5-difluorophenyl)methanone
deuterio-(3,5-difluorophenyl)methanone (PubChem CID 168824116) has the molecular formula C7H4F2O
and a molecular weight of 143.11 g/mol. Its IUPAC name is deuterio-(3,5-difluorophenyl)methanone.
Molecular Properties
| Compound Name | deuterio-(3,5-difluorophenyl)methanone |
| PubChem CID | 168824116 |
| Molecular Formula | C7H4F2O |
| Molecular Weight | 143.11 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | deuterio-(3,5-difluorophenyl)methanone |
| SMILES | [2H]C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H4F2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H/i4D |
| InChIKey | ASOFZHSTJHGQDT-QYKNYGDISA-N |
| XLogP | 1.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze deuterio-(3,5-difluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio-(3,5-difluorophenyl)methanone?
The IUPAC name of deuterio-(3,5-difluorophenyl)methanone (CID 168824116) is deuterio-(3,5-difluorophenyl)methanone.
What is the SMILES notation for deuterio-(3,5-difluorophenyl)methanone?
The canonical SMILES for deuterio-(3,5-difluorophenyl)methanone is [2H]C(=O)c1cc(F)cc(F)c1.
What is the InChIKey of deuterio-(3,5-difluorophenyl)methanone?
The InChIKey is ASOFZHSTJHGQDT-QYKNYGDISA-N. The full InChI is InChI=1S/C7H4F2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H/i4D.
What are the key properties of deuterio-(3,5-difluorophenyl)methanone?
deuterio-(3,5-difluorophenyl)methanone has a molecular weight of 143.11 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio-(3,5-difluorophenyl)methanone is sourced from PubChem (CID 168824116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).