About 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate
7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate (PubChem CID 168824329) has the molecular formula C25H28FNO5
and a molecular weight of 441.50 g/mol. Its IUPAC name is 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate |
| PubChem CID | 168824329 |
| Molecular Formula | C25H28FNO5 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCCCn1cc2cc(-c3cccc(F)c3)c(=O)oc2cc1=O |
| InChI | InChI=1S/C25H28FNO5/c1-17(2)24(29)31-12-7-5-3-4-6-11-27-16-19-14-21(18-9-8-10-20(26)13-18)25(30)32-22(19)15-23(27)28/h8-10,13-17H,3-7,11-12H2,1-2H3 |
| InChIKey | UBRKUUWSRYWIJT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate?
The IUPAC name of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate (CID 168824329) is 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate.
What is the SMILES notation for 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate?
The canonical SMILES for 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate is CC(C)C(=O)OCCCCCCCn1cc2cc(-c3cccc(F)c3)c(=O)oc2cc1=O.
What is the InChIKey of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate?
The InChIKey is UBRKUUWSRYWIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28FNO5/c1-17(2)24(29)31-12-7-5-3-4-6-11-27-16-19-14-21(18-9-8-10-20(26)13-18)25(30)32-22(19)15-23(27)28/h8-10,13-17H,3-7,11-12H2,1-2H3.
What are the key properties of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate?
7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate has a molecular weight of 441.50 g/mol, XLogP of 4.91, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylpropanoate is sourced from PubChem (CID 168824329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).