C26H28F3NO5S — CID 168824333
8-[2,8-dioxo-3-[2-[(trifluoro-λ4-sulfanyl)methyl]phenyl]pyrano[2,3-c]pyridin-7-yl]octyl prop-2-enoate (PubChem CID 168824333) has the molecular formula C26H28F3NO5S and a molecular weight of 523.57 g/mol. Its IUPAC name is 8-[2,8-dioxo-3-[2-[(trifluoro-λ4-sulfanyl)methyl]phenyl]pyrano[2,3-c]pyridin-7-yl]octyl prop-2-enoate.
| Compound Name | 8-[2,8-dioxo-3-[2-[(trifluoro-λ4-sulfanyl)methyl]phenyl]pyrano[2,3-c]pyridin-7-yl]octyl prop-2-enoate |
|---|---|
| PubChem CID | 168824333 |
| Molecular Formula | C26H28F3NO5S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 8-[2,8-dioxo-3-[2-[(trifluoro-λ4-sulfanyl)methyl]phenyl]pyrano[2,3-c]pyridin-7-yl]octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCn1ccc2cc(-c3ccccc3CS(F)(F)F)c(=O)oc2c1=O |
| InChI | InChI=1S/C26H28F3NO5S/c1-2-23(31)34-16-10-6-4-3-5-9-14-30-15-13-19-17-22(26(33)35-24(19)25(30)32)21-12-8-7-11-20(21)18-36(27,28)29/h2,7-8,11-13,15,17H,1,3-6,9-10,14,16,18H2 |
| InChIKey | CTAKTHMURRMESA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|