C11H11N3OS — CID 168824413
(NE)-N-[[4-(2-pyridin-3-ylethyl)-1,3-thiazol-2-yl]methylidene]hydroxylamine (PubChem CID 168824413) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is (NE)-N-[[4-(2-pyridin-3-ylethyl)-1,3-thiazol-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-(2-pyridin-3-ylethyl)-1,3-thiazol-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 168824413 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | (NE)-N-[[4-(2-pyridin-3-ylethyl)-1,3-thiazol-2-yl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1nc(CCc2cccnc2)cs1 |
| InChI | InChI=1S/C11H11N3OS/c15-13-7-11-14-10(8-16-11)4-3-9-2-1-5-12-6-9/h1-2,5-8,15H,3-4H2/b13-7+ |
| InChIKey | DJOORBNXAQSIEV-NTUHNPAUSA-N |
| XLogP | 2.13 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|