About 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide
5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 168824579) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide |
| PubChem CID | 168824579 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)C1=CCC(C(N)=O)N1 |
| InChI | InChI=1S/C7H10N2O2/c1-4(10)5-2-3-6(9-5)7(8)11/h2,6,9H,3H2,1H3,(H2,8,11) |
| InChIKey | SDWVJMQNVKQCSM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide?
The IUPAC name of 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide (CID 168824579) is 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide?
The canonical SMILES for 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide is CC(=O)C1=CCC(C(N)=O)N1.
What is the InChIKey of 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide?
The InChIKey is SDWVJMQNVKQCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4(10)5-2-3-6(9-5)7(8)11/h2,6,9H,3H2,1H3,(H2,8,11).
What are the key properties of 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide?
5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide has a molecular weight of 154.17 g/mol, XLogP of -0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2,3-dihydro-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 168824579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).