C13H18FN3O3 — CID 168824705
tert-butyl 3-[(3-fluoropyrazin-2-yl)-hydroxymethyl]azetidine-1-carboxylate (PubChem CID 168824705) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is tert-butyl 3-[(3-fluoropyrazin-2-yl)-hydroxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-fluoropyrazin-2-yl)-hydroxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168824705 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | tert-butyl 3-[(3-fluoropyrazin-2-yl)-hydroxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(O)c2nccnc2F)C1 |
| InChI | InChI=1S/C13H18FN3O3/c1-13(2,3)20-12(19)17-6-8(7-17)10(18)9-11(14)16-5-4-15-9/h4-5,8,10,18H,6-7H2,1-3H3 |
| InChIKey | DKNDAKICCQMNIU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |