C22H22F3N5O3 — CID 168825015
N-[[4-(4-hydroxypiperidin-1-yl)-1-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-b]pyridin-3-yl]methyl]prop-2-enamide (PubChem CID 168825015) has the molecular formula C22H22F3N5O3 and a molecular weight of 461.44 g/mol. Its IUPAC name is N-[[4-(4-hydroxypiperidin-1-yl)-1-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-b]pyridin-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[4-(4-hydroxypiperidin-1-yl)-1-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-b]pyridin-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168825015 |
| Molecular Formula | C22H22F3N5O3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[[4-(4-hydroxypiperidin-1-yl)-1-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-b]pyridin-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1nn(-c2ccc(OC(F)(F)F)cc2)c2nccc(N3CCC(O)CC3)c12 |
| InChI | InChI=1S/C22H22F3N5O3/c1-2-19(32)27-13-17-20-18(29-11-8-15(31)9-12-29)7-10-26-21(20)30(28-17)14-3-5-16(6-4-14)33-22(23,24)25/h2-7,10,15,31H,1,8-9,11-13H2,(H,27,32) |
| InChIKey | CKZAPUZJNWWARP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|