C12H9F8NO5S — CID 168826330
5-hydroxy-2-(3,3,4,4,4-pentafluorobutoxy)-N-(trifluoromethylsulfonyl)benzamide (PubChem CID 168826330) has the molecular formula C12H9F8NO5S and a molecular weight of 431.26 g/mol. Its IUPAC name is 5-hydroxy-2-(3,3,4,4,4-pentafluorobutoxy)-N-(trifluoromethylsulfonyl)benzamide.
| Compound Name | 5-hydroxy-2-(3,3,4,4,4-pentafluorobutoxy)-N-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 168826330 |
| Molecular Formula | C12H9F8NO5S |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 5-hydroxy-2-(3,3,4,4,4-pentafluorobutoxy)-N-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)F)c1cc(O)ccc1OCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F8NO5S/c13-10(14,11(15,16)17)3-4-26-8-2-1-6(22)5-7(8)9(23)21-27(24,25)12(18,19)20/h1-2,5,22H,3-4H2,(H,21,23) |
| InChIKey | RVQFMXKROWUUQC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|