C58H35N3O2 — CID 168826414
4-[8-(9-phenylcarbazol-3-yl)dibenzofuran-1-yl]-9-[3-(4-phenylphenyl)phenyl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 168826414) has the molecular formula C58H35N3O2 and a molecular weight of 805.94 g/mol. Its IUPAC name is 4-[8-(9-phenylcarbazol-3-yl)dibenzofuran-1-yl]-9-[3-(4-phenylphenyl)phenyl]-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-[8-(9-phenylcarbazol-3-yl)dibenzofuran-1-yl]-9-[3-(4-phenylphenyl)phenyl]-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 168826414 |
| Molecular Formula | C58H35N3O2 |
| Molecular Weight | 805.94 g/mol |
| Exact Mass | 805.27 |
| IUPAC Name | 4-[8-(9-phenylcarbazol-3-yl)dibenzofuran-1-yl]-9-[3-(4-phenylphenyl)phenyl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cccc(-c4cccc5oc6c(-c7cccc8oc9ccc(-c%10ccc%11c(c%10)c%10ccccc%10n%11-c%10ccccc%10)cc9c78)ncnc6c45)c3)cc2)cc1 |
| InChI | InChI=1S/C58H35N3O2/c1-3-12-36(13-4-1)37-24-26-38(27-25-37)39-14-9-15-42(32-39)44-19-10-23-53-55(44)57-58(63-53)56(59-35-60-57)46-20-11-22-52-54(46)48-34-41(29-31-51(48)62-52)40-28-30-50-47(33-40)45-18-7-8-21-49(45)61(50)43-16-5-2-6-17-43/h1-35H |
| InChIKey | JVYXGOQTHBQKCF-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.94 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |