C17H20F3N3O — CID 168826757
2-methyl-6-(2-methyl-1H-imidazol-5-yl)-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 168826757) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-methyl-6-(2-methyl-1H-imidazol-5-yl)-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 2-methyl-6-(2-methyl-1H-imidazol-5-yl)-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 168826757 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-methyl-6-(2-methyl-1H-imidazol-5-yl)-4-[4-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | Cc1ncc(C2CC(O)(c3ccc(C(F)(F)F)cc3)CC(C)N2)[nH]1 |
| InChI | InChI=1S/C17H20F3N3O/c1-10-7-16(24,8-14(22-10)15-9-21-11(2)23-15)12-3-5-13(6-4-12)17(18,19)20/h3-6,9-10,14,22,24H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | GEHYROTTYCBAOL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |