C8H17NO — CID 168826968
(2R,6S)-2,4,6-trimethylpiperidin-4-ol (PubChem CID 168826968) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (2R,6S)-2,4,6-trimethylpiperidin-4-ol.
| Compound Name | (2R,6S)-2,4,6-trimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 168826968 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (2R,6S)-2,4,6-trimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CC(C)(O)C[C@H](C)N1 |
| InChI | InChI=1S/C8H17NO/c1-6-4-8(3,10)5-7(2)9-6/h6-7,9-10H,4-5H2,1-3H3/t6-,7+,8? |
| InChIKey | AGAPVEHFXIWQAH-DHBOJHSNSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |