C23H27N7O2 — CID 168827122
6-amino-2-[(1S,3R)-3-[(5-isocyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3H-isoindol-1-one (PubChem CID 168827122) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 6-amino-2-[(1S,3R)-3-[(5-isocyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3H-isoindol-1-one.
| Compound Name | 6-amino-2-[(1S,3R)-3-[(5-isocyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 168827122 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 6-amino-2-[(1S,3R)-3-[(5-isocyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3H-isoindol-1-one |
| SMILES | [C-]#[N+]c1cnc(N[C@@H]2CCC[C@H](N3Cc4ccc(N)cc4C3=O)C2)nc1N1CCOCC1 |
| InChI | InChI=1S/C23H27N7O2/c1-25-20-13-26-23(28-21(20)29-7-9-32-10-8-29)27-17-3-2-4-18(12-17)30-14-15-5-6-16(24)11-19(15)22(30)31/h5-6,11,13,17-18H,2-4,7-10,12,14,24H2,(H,26,27,28)/t17-,18+/m1/s1 |
| InChIKey | KEYHBDAREBCOGK-MSOLQXFVSA-N |
| XLogP | 2.83 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|