About 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol
6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol (PubChem CID 168829297) has the molecular formula C25H24FNOS
and a molecular weight of 405.54 g/mol. Its IUPAC name is 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol.
Molecular Properties
| Compound Name | 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol |
| PubChem CID | 168829297 |
| Molecular Formula | C25H24FNOS |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol |
| SMILES | Cc1cc2ccc(-c3cccc(-c4cc(CC(C)(C)C)ccn4)c3F)c(O)c2s1 |
| InChI | InChI=1S/C25H24FNOS/c1-15-12-17-8-9-19(23(28)24(17)29-15)18-6-5-7-20(22(18)26)21-13-16(10-11-27-21)14-25(2,3)4/h5-13,28H,14H2,1-4H3 |
| InChIKey | NEAQQESJQLIJSX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol?
The IUPAC name of 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol (CID 168829297) is 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol.
What is the SMILES notation for 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol?
The canonical SMILES for 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol is Cc1cc2ccc(-c3cccc(-c4cc(CC(C)(C)C)ccn4)c3F)c(O)c2s1.
What is the InChIKey of 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol?
The InChIKey is NEAQQESJQLIJSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24FNOS/c1-15-12-17-8-9-19(23(28)24(17)29-15)18-6-5-7-20(22(18)26)21-13-16(10-11-27-21)14-25(2,3)4/h5-13,28H,14H2,1-4H3.
What are the key properties of 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol?
6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol has a molecular weight of 405.54 g/mol, XLogP of 7.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-2-methyl-1-benzothiophen-7-ol is sourced from PubChem (CID 168829297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).