About 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol
5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol (PubChem CID 168829756) has the molecular formula C24H22FNOS
and a molecular weight of 391.51 g/mol. Its IUPAC name is 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol.
Molecular Properties
| Compound Name | 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol |
| PubChem CID | 168829756 |
| Molecular Formula | C24H22FNOS |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol |
| SMILES | CC(C)(C)Cc1ccnc(-c2cccc(-c3cc4ccsc4cc3O)c2F)c1 |
| InChI | InChI=1S/C24H22FNOS/c1-24(2,3)14-15-7-9-26-20(11-15)18-6-4-5-17(23(18)25)19-12-16-8-10-28-22(16)13-21(19)27/h4-13,27H,14H2,1-3H3 |
| InChIKey | NOHCACPXJRDLFU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol?
The IUPAC name of 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol (CID 168829756) is 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol.
What is the SMILES notation for 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol?
The canonical SMILES for 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol is CC(C)(C)Cc1ccnc(-c2cccc(-c3cc4ccsc4cc3O)c2F)c1.
What is the InChIKey of 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol?
The InChIKey is NOHCACPXJRDLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FNOS/c1-24(2,3)14-15-7-9-26-20(11-15)18-6-4-5-17(23(18)25)19-12-16-8-10-28-22(16)13-21(19)27/h4-13,27H,14H2,1-3H3.
What are the key properties of 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol?
5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol has a molecular weight of 391.51 g/mol, XLogP of 7.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[4-(2,2-dimethylpropyl)-2-pyridinyl]-2-fluorophenyl]-1-benzothiophen-6-ol is sourced from PubChem (CID 168829756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).