C38H35NO9 — CID 168830107
3-[4-[(5S,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-6-hydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]phenyl]propanoic acid (PubChem CID 168830107) has the molecular formula C38H35NO9 and a molecular weight of 649.70 g/mol. Its IUPAC name is 3-[4-[(5S,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-6-hydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(5S,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-6-hydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 168830107 |
| Molecular Formula | C38H35NO9 |
| Molecular Weight | 649.70 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 3-[4-[(5S,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-6-hydroxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]phenyl]propanoic acid |
| SMILES | COc1ccc(C(O[C@@H]2C3OC(C4C(=O)N(c5ccc(CCC(=O)O)cc5)C(=O)C43)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H35NO9/c1-45-27-17-11-24(12-18-27)38(23-6-4-3-5-7-23,25-13-19-28(46-2)20-14-25)48-35-32(42)33-30-31(34(35)47-33)37(44)39(36(30)43)26-15-8-22(9-16-26)10-21-29(40)41/h3-9,11-20,30-35,42H,10,21H2,1-2H3,(H,40,41)/t30?,31?,32-,33?,34?,35-/m0/s1 |
| InChIKey | HRIBQQZEALMJMO-ONWJGUKOSA-N |
| XLogP | 4.35 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|