About benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate
benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate (PubChem CID 168830182) has the molecular formula C31H34FNO2
and a molecular weight of 471.62 g/mol. Its IUPAC name is benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate.
Molecular Properties
| Compound Name | benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate |
| PubChem CID | 168830182 |
| Molecular Formula | C31H34FNO2 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate |
| SMILES | CCC(C)CC(CC(F)(CCC#N)C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34FNO2/c1-3-25(2)22-30(27-16-9-5-10-17-27,28-18-11-6-12-19-28)24-31(32,20-13-21-33)29(34)35-23-26-14-7-4-8-15-26/h4-12,14-19,25H,3,13,20,22-24H2,1-2H3 |
| InChIKey | HMCZLBHAXRSHCQ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate?
The IUPAC name of benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate (CID 168830182) is benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate.
What is the SMILES notation for benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate?
The canonical SMILES for benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate is CCC(C)CC(CC(F)(CCC#N)C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate?
The InChIKey is HMCZLBHAXRSHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34FNO2/c1-3-25(2)22-30(27-16-9-5-10-17-27,28-18-11-6-12-19-28)24-31(32,20-13-21-33)29(34)35-23-26-14-7-4-8-15-26/h4-12,14-19,25H,3,13,20,22-24H2,1-2H3.
What are the key properties of benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate?
benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate has a molecular weight of 471.62 g/mol, XLogP of 7.55, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2-cyanoethyl)-2-fluoro-6-methyl-4,4-diphenyloctanoate is sourced from PubChem (CID 168830182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).