C20H37N5O — CID 168830450
2-[6-cyclohexyl-8-(1-methylpyrazolidin-3-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl]-N-methylacetamide (PubChem CID 168830450) has the molecular formula C20H37N5O and a molecular weight of 363.55 g/mol. Its IUPAC name is 2-[6-cyclohexyl-8-(1-methylpyrazolidin-3-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl]-N-methylacetamide.
| Compound Name | 2-[6-cyclohexyl-8-(1-methylpyrazolidin-3-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 168830450 |
| Molecular Formula | C20H37N5O |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.30 |
| IUPAC Name | 2-[6-cyclohexyl-8-(1-methylpyrazolidin-3-yl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1CN2CC(C3CCCCC3)CC(C3CCN(C)N3)C2N1 |
| InChI | InChI=1S/C20H37N5O/c1-21-19(26)11-16-13-25-12-15(14-6-4-3-5-7-14)10-17(20(25)22-16)18-8-9-24(2)23-18/h14-18,20,22-23H,3-13H2,1-2H3,(H,21,26) |
| InChIKey | QVYHSPRMUOIRQN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |