C50H43N4OPt-3 — CID 168830498
2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-6-phenyl-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 168830498) has the molecular formula C50H43N4OPt-3 and a molecular weight of 911.00 g/mol. Its IUPAC name is 2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-6-phenyl-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-6-phenyl-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 168830498 |
| Molecular Formula | C50H43N4OPt-3 |
| Molecular Weight | 911.00 g/mol |
| Exact Mass | 910.31 |
| IUPAC Name | 2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-6-phenyl-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1cc(N2[CH-]N(c3[c-]c(Oc4[c-]c5c(cc4)c4cc(-c6ccccc6)ccc4n5-c4ccccn4)ccc3)c3ccccc32)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C50H43N4O.Pt/c1-49(2,3)36-28-37(50(4,5)6)30-39(29-36)53-33-52(45-19-10-11-20-46(45)53)38-17-14-18-40(31-38)55-41-23-24-42-43-27-35(34-15-8-7-9-16-34)22-25-44(43)54(47(42)32-41)48-21-12-13-26-51-48;/h7-30,33H,1-6H3;/q-3; |
| InChIKey | QJJONNPJVVISAB-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.00 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|