C18H21OPS2 — CID 168831123
(2S,3aS,5R,7aS)-7a-methyl-2-(2-phenylethynyl)-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole (PubChem CID 168831123) has the molecular formula C18H21OPS2 and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S,3aS,5R,7aS)-7a-methyl-2-(2-phenylethynyl)-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole.
| Compound Name | (2S,3aS,5R,7aS)-7a-methyl-2-(2-phenylethynyl)-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole |
|---|---|
| PubChem CID | 168831123 |
| Molecular Formula | C18H21OPS2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2S,3aS,5R,7aS)-7a-methyl-2-(2-phenylethynyl)-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)O[P@](=S)(C#Cc3ccccc3)S[C@H]2C1 |
| InChI | InChI=1S/C18H21OPS2/c1-14(2)16-9-11-18(3)17(13-16)22-20(21,19-18)12-10-15-7-5-4-6-8-15/h4-8,16-17H,1,9,11,13H2,2-3H3/t16-,17+,18+,20+/m1/s1 |
| InChIKey | JBJUTZDPMBAHMU-LXZJYRNTSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|