C30H33N3O — CID 168831710
(9S,13S,16R)-9-benzyl-13-methyl-3-[(4-methylpyrimidin-5-yl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol (PubChem CID 168831710) has the molecular formula C30H33N3O and a molecular weight of 451.61 g/mol. Its IUPAC name is (9S,13S,16R)-9-benzyl-13-methyl-3-[(4-methylpyrimidin-5-yl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (9S,13S,16R)-9-benzyl-13-methyl-3-[(4-methylpyrimidin-5-yl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 168831710 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (9S,13S,16R)-9-benzyl-13-methyl-3-[(4-methylpyrimidin-5-yl)amino]-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol |
| SMILES | Cc1ncncc1Nc1ccc2c(c1)CCC1=C3C[C@H](O)C[C@]3(C)CC[C@]12Cc1ccccc1 |
| InChI | InChI=1S/C30H33N3O/c1-20-28(18-31-19-32-20)33-23-9-11-25-22(14-23)8-10-26-27-15-24(34)17-29(27,2)12-13-30(25,26)16-21-6-4-3-5-7-21/h3-7,9,11,14,18-19,24,33-34H,8,10,12-13,15-17H2,1-2H3/t24-,29-,30+/m0/s1 |
| InChIKey | VKUBXLNVYQUCFV-QZFRTWIZSA-N |
| XLogP | 6.21 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|