C26H24Cl2N4O3 — CID 168832258
(3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-N-[(1R)-1-(3-chlorophenyl)ethyl]-2-oxo-1H-indole-5-carboxamide (PubChem CID 168832258) has the molecular formula C26H24Cl2N4O3 and a molecular weight of 511.41 g/mol. Its IUPAC name is (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-N-[(1R)-1-(3-chlorophenyl)ethyl]-2-oxo-1H-indole-5-carboxamide.
| Compound Name | (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-N-[(1R)-1-(3-chlorophenyl)ethyl]-2-oxo-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 168832258 |
| Molecular Formula | C26H24Cl2N4O3 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-N-[(1R)-1-(3-chlorophenyl)ethyl]-2-oxo-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)N[C@H](C)c4cccc(Cl)c4)cc32)c(C)c1NC(=O)CCl |
| InChI | InChI=1S/C26H24Cl2N4O3/c1-13-22(29-15(3)24(13)32-23(33)12-27)11-20-19-10-17(7-8-21(19)31-26(20)35)25(34)30-14(2)16-5-4-6-18(28)9-16/h4-11,14,29H,12H2,1-3H3,(H,30,34)(H,31,35)(H,32,33)/b20-11-/t14-/m1/s1 |
| InChIKey | NCVWPKQAGKDNPY-LPKQHDGYSA-N |
| XLogP | 5.45 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|