C22H22FN7O2 — CID 168833216
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-fluoro-4-(1-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-yl)phenyl]urea (PubChem CID 168833216) has the molecular formula C22H22FN7O2 and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-fluoro-4-(1-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-yl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-fluoro-4-(1-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 168833216 |
| Molecular Formula | C22H22FN7O2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-fluoro-4-(1-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-yl)phenyl]urea |
| SMILES | C=CCn1nc(-c2ccc(NC(=O)Nc3cc(C(C)(C)C)on3)c(F)c2)c2cncnc21 |
| InChI | InChI=1S/C22H22FN7O2/c1-5-8-30-20-14(11-24-12-25-20)19(28-30)13-6-7-16(15(23)9-13)26-21(31)27-18-10-17(32-29-18)22(2,3)4/h5-7,9-12H,1,8H2,2-4H3,(H2,26,27,29,31) |
| InChIKey | TWZUGLCTIQKZER-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|