C42H40Si2 — CID 168834161
di(cyclohexa-2,4-dien-1-yl)-phenyl-(3-triphenylsilylcyclohexa-1,5-dien-1-yl)silane (PubChem CID 168834161) has the molecular formula C42H40Si2 and a molecular weight of 600.95 g/mol. Its IUPAC name is di(cyclohexa-2,4-dien-1-yl)-phenyl-(3-triphenylsilylcyclohexa-1,5-dien-1-yl)silane.
| Compound Name | di(cyclohexa-2,4-dien-1-yl)-phenyl-(3-triphenylsilylcyclohexa-1,5-dien-1-yl)silane |
|---|---|
| PubChem CID | 168834161 |
| Molecular Formula | C42H40Si2 |
| Molecular Weight | 600.95 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | di(cyclohexa-2,4-dien-1-yl)-phenyl-(3-triphenylsilylcyclohexa-1,5-dien-1-yl)silane |
| SMILES | C1=CCC([Si](C2=CC([Si](c3ccccc3)(c3ccccc3)c3ccccc3)CC=C2)(c2ccccc2)C2C=CC=CC2)C=C1 |
| InChI | InChI=1S/C42H40Si2/c1-7-20-35(21-8-1)43(36-22-9-2-10-23-36,37-24-11-3-12-25-37)41-32-19-33-42(34-41)44(38-26-13-4-14-27-38,39-28-15-5-16-29-39)40-30-17-6-18-31-40/h1-28,30,33-34,39-41H,29,31-32H2 |
| InChIKey | YRJWKUPYAQYNIV-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.95 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|