C20H37NO3Si — CID 168834262
tert-butyl (2R)-2-[[(2R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-trimethylsilylpropanoate (PubChem CID 168834262) has the molecular formula C20H37NO3Si and a molecular weight of 367.61 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-trimethylsilylpropanoate.
| Compound Name | tert-butyl (2R)-2-[[(2R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-trimethylsilylpropanoate |
|---|---|
| PubChem CID | 168834262 |
| Molecular Formula | C20H37NO3Si |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl (2R)-2-[[(2R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]-3-trimethylsilylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C[Si](C)(C)C)/N=C1\CC2CC(C2(C)C)[C@@]1(C)O |
| InChI | InChI=1S/C20H37NO3Si/c1-18(2,3)24-17(22)14(12-25(7,8)9)21-16-11-13-10-15(19(13,4)5)20(16,6)23/h13-15,23H,10-12H2,1-9H3/b21-16+/t13?,14-,15?,20+/m0/s1 |
| InChIKey | DRFJLJSBHLJKFX-UNGKCUEESA-N |
| XLogP | 4.29 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|