About 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene
4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene (PubChem CID 168837355) has the molecular formula C16H21F3
and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene |
| PubChem CID | 168837355 |
| Molecular Formula | C16H21F3 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene |
| SMILES | Cc1ccc(C2CCC(C)(C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H21F3/c1-11-4-5-13(10-14(11)16(17,18)19)12-6-8-15(2,3)9-7-12/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | JWUHJKQADCIRIL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene?
The IUPAC name of 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene (CID 168837355) is 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene.
What is the SMILES notation for 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene?
The canonical SMILES for 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene is Cc1ccc(C2CCC(C)(C)CC2)cc1C(F)(F)F.
What is the InChIKey of 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene?
The InChIKey is JWUHJKQADCIRIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3/c1-11-4-5-13(10-14(11)16(17,18)19)12-6-8-15(2,3)9-7-12/h4-5,10,12H,6-9H2,1-3H3.
What are the key properties of 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene?
4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene has a molecular weight of 270.34 g/mol, XLogP of 5.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(trifluoromethyl)benzene is sourced from PubChem (CID 168837355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).