About sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate
sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate (PubChem CID 168837420) has the molecular formula C17H12F3NaO4S
and a molecular weight of 392.33 g/mol. Its IUPAC name is sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate.
Molecular Properties
| Compound Name | sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate |
| PubChem CID | 168837420 |
| Molecular Formula | C17H12F3NaO4S |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate |
| SMILES | COOSc1cccc(-c2ccc(C(=O)/C=C(\[O-])C(F)(F)F)cc2)c1.[Na+] |
| InChI | InChI=1S/C17H13F3O4S.Na/c1-23-24-25-14-4-2-3-13(9-14)11-5-7-12(8-6-11)15(21)10-16(22)17(18,19)20;/h2-10,22H,1H3;/q;+1/p-1/b16-10-; |
| InChIKey | MXFSHYKDEDMULS-HYMQDMCPSA-M |
| XLogP | 0.93 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate?
The IUPAC name of sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate (CID 168837420) is sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate.
What is the SMILES notation for sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate?
The canonical SMILES for sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate is COOSc1cccc(-c2ccc(C(=O)/C=C(\[O-])C(F)(F)F)cc2)c1.[Na+].
What is the InChIKey of sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate?
The InChIKey is MXFSHYKDEDMULS-HYMQDMCPSA-M. The full InChI is InChI=1S/C17H13F3O4S.Na/c1-23-24-25-14-4-2-3-13(9-14)11-5-7-12(8-6-11)15(21)10-16(22)17(18,19)20;/h2-10,22H,1H3;/q;+1/p-1/b16-10-;.
What are the key properties of sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate?
sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate has a molecular weight of 392.33 g/mol, XLogP of 0.93, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (Z)-1,1,1-trifluoro-4-[4-(3-methylperoxysulfanylphenyl)phenyl]-4-oxobut-2-en-2-olate is sourced from PubChem (CID 168837420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).