C24H33BN4O4 — CID 168837641
1,7-bis(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,3-f]indazole (PubChem CID 168837641) has the molecular formula C24H33BN4O4 and a molecular weight of 452.36 g/mol. Its IUPAC name is 1,7-bis(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,3-f]indazole.
| Compound Name | 1,7-bis(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,3-f]indazole |
|---|---|
| PubChem CID | 168837641 |
| Molecular Formula | C24H33BN4O4 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 1,7-bis(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[4,3-f]indazole |
| SMILES | CC1(C)OB(c2c3cnn(C4CCCCO4)c3cc3c2cnn3C2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C24H33BN4O4/c1-23(2)24(3,4)33-25(32-23)22-16-14-26-28(20-9-5-7-11-30-20)18(16)13-19-17(22)15-27-29(19)21-10-6-8-12-31-21/h13-15,20-21H,5-12H2,1-4H3 |
| InChIKey | AENSZKIFYQSCIB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|