C11H13FLiN3O3 — CID 168838975
lithium 1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidine-4-carboxylate (PubChem CID 168838975) has the molecular formula C11H13FLiN3O3 and a molecular weight of 261.18 g/mol. Its IUPAC name is lithium 1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidine-4-carboxylate.
| Compound Name | lithium 1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168838975 |
| Molecular Formula | C11H13FLiN3O3 |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | lithium 1-(5-fluoro-4-methoxypyrimidin-2-yl)piperidine-4-carboxylate |
| SMILES | COc1nc(N2CCC(C(=O)[O-])CC2)ncc1F.[Li+] |
| InChI | InChI=1S/C11H14FN3O3.Li/c1-18-9-8(12)6-13-11(14-9)15-4-2-7(3-5-15)10(16)17;/h6-7H,2-5H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | CBEHZCNHVGQWPF-UHFFFAOYSA-M |
| XLogP | -3.41 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |