C19H21N7O2 — CID 168838981
[1-(6-isocyanopyrimidin-4-yl)piperidin-4-yl]-[(3S)-3-(5-methylpyrazin-2-yl)-1,2-oxazolidin-2-yl]methanone (PubChem CID 168838981) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is [1-(6-isocyanopyrimidin-4-yl)piperidin-4-yl]-[(3S)-3-(5-methylpyrazin-2-yl)-1,2-oxazolidin-2-yl]methanone.
| Compound Name | [1-(6-isocyanopyrimidin-4-yl)piperidin-4-yl]-[(3S)-3-(5-methylpyrazin-2-yl)-1,2-oxazolidin-2-yl]methanone |
|---|---|
| PubChem CID | 168838981 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [1-(6-isocyanopyrimidin-4-yl)piperidin-4-yl]-[(3S)-3-(5-methylpyrazin-2-yl)-1,2-oxazolidin-2-yl]methanone |
| SMILES | [C-]#[N+]c1cc(N2CCC(C(=O)N3OCC[C@H]3c3cnc(C)cn3)CC2)ncn1 |
| InChI | InChI=1S/C19H21N7O2/c1-13-10-22-15(11-21-13)16-5-8-28-26(16)19(27)14-3-6-25(7-4-14)18-9-17(20-2)23-12-24-18/h9-12,14,16H,3-8H2,1H3/t16-/m0/s1 |
| InChIKey | SXGVSXRMJULXII-INIZCTEOSA-N |
| XLogP | 2.25 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|