C20H27N7 — CID 168839213
7-N-butyl-2-[[4-[(2R)-pyrrolidin-2-yl]phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine (PubChem CID 168839213) has the molecular formula C20H27N7 and a molecular weight of 365.49 g/mol. Its IUPAC name is 7-N-butyl-2-[[4-[(2R)-pyrrolidin-2-yl]phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-2-[[4-[(2R)-pyrrolidin-2-yl]phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 168839213 |
| Molecular Formula | C20H27N7 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 7-N-butyl-2-[[4-[(2R)-pyrrolidin-2-yl]phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3ccc([C@H]4CCCN4)cc3)nc12 |
| InChI | InChI=1S/C20H27N7/c1-2-3-10-23-19-18-17(24-20(21)25-19)13-27(26-18)12-14-6-8-15(9-7-14)16-5-4-11-22-16/h6-9,13,16,22H,2-5,10-12H2,1H3,(H3,21,23,24,25)/t16-/m1/s1 |
| InChIKey | YEJQUEOWRZTBFK-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|