C63H43N5Si — CID 168842667
diphenyl-(3-phenylphenyl)-[4-[4-phenyl-6-(5-phenylindolo[3,2-c]carbazol-12-yl)-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 168842667) has the molecular formula C63H43N5Si and a molecular weight of 898.16 g/mol. Its IUPAC name is diphenyl-(3-phenylphenyl)-[4-[4-phenyl-6-(5-phenylindolo[3,2-c]carbazol-12-yl)-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | diphenyl-(3-phenylphenyl)-[4-[4-phenyl-6-(5-phenylindolo[3,2-c]carbazol-12-yl)-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 168842667 |
| Molecular Formula | C63H43N5Si |
| Molecular Weight | 898.16 g/mol |
| Exact Mass | 897.33 |
| IUPAC Name | diphenyl-(3-phenylphenyl)-[4-[4-phenyl-6-(5-phenylindolo[3,2-c]carbazol-12-yl)-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | c1ccc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccc(-c4nc(-c5ccccc5)nc(-n5c6ccccc6c6ccc7c(c8ccccc8n7-c7ccccc7)c65)n4)cc3)c2)cc1 |
| InChI | InChI=1S/C63H43N5Si/c1-6-21-44(22-7-1)47-25-20-32-52(43-47)69(49-28-12-4-13-29-49,50-30-14-5-15-31-50)51-39-37-46(38-40-51)62-64-61(45-23-8-2-9-24-45)65-63(66-62)68-56-35-18-16-33-53(56)54-41-42-58-59(60(54)68)55-34-17-19-36-57(55)67(58)48-26-10-3-11-27-48/h1-43H |
| InChIKey | WYBGTTYYKSXPDE-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.16 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|