C45H36N2O — CID 168843828
1-[1-(3,5-dimethylphenyl)benzimidazol-2-yl]-3-[(E)-4-(3-phenylnaphthalen-1-yl)but-2-enyl]naphthalen-2-ol (PubChem CID 168843828) has the molecular formula C45H36N2O and a molecular weight of 620.80 g/mol. Its IUPAC name is 1-[1-(3,5-dimethylphenyl)benzimidazol-2-yl]-3-[(E)-4-(3-phenylnaphthalen-1-yl)but-2-enyl]naphthalen-2-ol.
| Compound Name | 1-[1-(3,5-dimethylphenyl)benzimidazol-2-yl]-3-[(E)-4-(3-phenylnaphthalen-1-yl)but-2-enyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 168843828 |
| Molecular Formula | C45H36N2O |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | 1-[1-(3,5-dimethylphenyl)benzimidazol-2-yl]-3-[(E)-4-(3-phenylnaphthalen-1-yl)but-2-enyl]naphthalen-2-ol |
| SMILES | Cc1cc(C)cc(-n2c(-c3c(O)c(C/C=C/Cc4cc(-c5ccccc5)cc5ccccc45)cc4ccccc34)nc3ccccc32)c1 |
| InChI | InChI=1S/C45H36N2O/c1-30-24-31(2)26-38(25-30)47-42-23-13-12-22-41(42)46-45(47)43-40-21-11-9-18-35(40)27-36(44(43)48)19-7-6-16-33-28-37(32-14-4-3-5-15-32)29-34-17-8-10-20-39(33)34/h3-15,17-18,20-29,48H,16,19H2,1-2H3/b7-6+ |
| InChIKey | LPVLVQCWVMQRCP-VOTSOKGWSA-N |
| XLogP | 11.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|