C13H13ClF3N5O — CID 168844112
[(3S)-3-(azidomethyl)pyrrolidin-1-yl]-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 168844112) has the molecular formula C13H13ClF3N5O and a molecular weight of 347.73 g/mol. Its IUPAC name is [(3S)-3-(azidomethyl)pyrrolidin-1-yl]-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(3S)-3-(azidomethyl)pyrrolidin-1-yl]-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 168844112 |
| Molecular Formula | C13H13ClF3N5O |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [(3S)-3-(azidomethyl)pyrrolidin-1-yl]-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1cc(C(F)(F)F)nc(Cl)c1C(=O)N1CC[C@H](CN=[N+]=[N-])C1 |
| InChI | InChI=1S/C13H13ClF3N5O/c1-7-4-9(13(15,16)17)20-11(14)10(7)12(23)22-3-2-8(6-22)5-19-21-18/h4,8H,2-3,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | CXHJSDRILQKBGX-MRVPVSSYSA-N |
| XLogP | 3.83 |
| TPSA | 81.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|