C29H30F3N5O3S — CID 168844352
3-[[7-[3-[(2S,6S)-2,6-dimethylpiperazine-1-carbonyl]-4-methyl-6-(trifluoromethyl)-2-pyridinyl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 168844352) has the molecular formula C29H30F3N5O3S and a molecular weight of 585.65 g/mol. Its IUPAC name is 3-[[7-[3-[(2S,6S)-2,6-dimethylpiperazine-1-carbonyl]-4-methyl-6-(trifluoromethyl)-2-pyridinyl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[7-[3-[(2S,6S)-2,6-dimethylpiperazine-1-carbonyl]-4-methyl-6-(trifluoromethyl)-2-pyridinyl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 168844352 |
| Molecular Formula | C29H30F3N5O3S |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 3-[[7-[3-[(2S,6S)-2,6-dimethylpiperazine-1-carbonyl]-4-methyl-6-(trifluoromethyl)-2-pyridinyl]thieno[3,2-b]pyridin-2-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(C(F)(F)F)nc(-c2ccnc3cc(CN4C(=O)C5C(C4=O)C5(C)C)sc23)c1C(=O)N1[C@@H](C)CNC[C@@H]1C |
| InChI | InChI=1S/C29H30F3N5O3S/c1-13-8-19(29(30,31)32)35-23(20(13)25(38)37-14(2)10-33-11-15(37)3)17-6-7-34-18-9-16(41-24(17)18)12-36-26(39)21-22(27(36)40)28(21,4)5/h6-9,14-15,21-22,33H,10-12H2,1-5H3/t14-,15-,21?,22?/m0/s1 |
| InChIKey | XWTKKCYJUKHWBO-RNXMBNEDSA-N |
| XLogP | 4.65 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|