C26H30FN7O — CID 168845886
2-[9-[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-5-methyl-7,8-dihydro-6H-pyridazino[3,4-b][1,4]diazepin-3-yl]-5-pyridazin-3-ylphenol (PubChem CID 168845886) has the molecular formula C26H30FN7O and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[9-[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-5-methyl-7,8-dihydro-6H-pyridazino[3,4-b][1,4]diazepin-3-yl]-5-pyridazin-3-ylphenol.
| Compound Name | 2-[9-[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-5-methyl-7,8-dihydro-6H-pyridazino[3,4-b][1,4]diazepin-3-yl]-5-pyridazin-3-ylphenol |
|---|---|
| PubChem CID | 168845886 |
| Molecular Formula | C26H30FN7O |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-[9-[(1R,2R,3S,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-5-methyl-7,8-dihydro-6H-pyridazino[3,4-b][1,4]diazepin-3-yl]-5-pyridazin-3-ylphenol |
| SMILES | CN1CCCN([C@H]2C[C@@H]3CCC[C@@H](N3)[C@H]2F)c2nnc(-c3ccc(-c4cccnn4)cc3O)cc21 |
| InChI | InChI=1S/C26H30FN7O/c1-33-11-4-12-34(22-14-17-5-2-6-20(29-17)25(22)27)26-23(33)15-21(31-32-26)18-9-8-16(13-24(18)35)19-7-3-10-28-30-19/h3,7-10,13,15,17,20,22,25,29,35H,2,4-6,11-12,14H2,1H3/t17-,20+,22-,25+/m0/s1 |
| InChIKey | KKGPUAGHEGWAFD-CDKSPMLISA-N |
| XLogP | 3.57 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |