About [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol
[3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol (PubChem CID 168846063) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol |
| PubChem CID | 168846063 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol |
| SMILES | OCc1cccc(C2CCC3(CC2)OCCO3)c1 |
| InChI | InChI=1S/C15H20O3/c16-11-12-2-1-3-14(10-12)13-4-6-15(7-5-13)17-8-9-18-15/h1-3,10,13,16H,4-9,11H2 |
| InChIKey | WJPSJTPDESWCQK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol?
The IUPAC name of [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol (CID 168846063) is [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol.
What is the SMILES notation for [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol?
The canonical SMILES for [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol is OCc1cccc(C2CCC3(CC2)OCCO3)c1.
What is the InChIKey of [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol?
The InChIKey is WJPSJTPDESWCQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c16-11-12-2-1-3-14(10-12)13-4-6-15(7-5-13)17-8-9-18-15/h1-3,10,13,16H,4-9,11H2.
What are the key properties of [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol?
[3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol has a molecular weight of 248.32 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,4-dioxaspiro[4.5]decan-8-yl)phenyl]methanol is sourced from PubChem (CID 168846063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).