C16H9ClN4O3 — CID 168846347
6-[4-(2-chloro-4-isocyanophenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid (PubChem CID 168846347) has the molecular formula C16H9ClN4O3 and a molecular weight of 340.73 g/mol. Its IUPAC name is 6-[4-(2-chloro-4-isocyanophenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[4-(2-chloro-4-isocyanophenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168846347 |
| Molecular Formula | C16H9ClN4O3 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 6-[4-(2-chloro-4-isocyanophenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid |
| SMILES | [C-]#[N+]c1ccc(-c2c[nH]n(-c3ccc(C(=O)O)cn3)c2=O)c(Cl)c1 |
| InChI | InChI=1S/C16H9ClN4O3/c1-18-10-3-4-11(13(17)6-10)12-8-20-21(15(12)22)14-5-2-9(7-19-14)16(23)24/h2-8,20H,(H,23,24) |
| InChIKey | UKMFUXGGRUCMCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|