About [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate
[2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate (PubChem CID 168846544) has the molecular formula C25H38N2O5
and a molecular weight of 446.59 g/mol. Its IUPAC name is [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate |
| PubChem CID | 168846544 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate |
| SMILES | CC1CCC(C(OC(=O)NC(C)(C)C)C(=O)Nc2ccc(C3CCOC(O)C3)cc2)CC1 |
| InChI | InChI=1S/C25H38N2O5/c1-16-5-7-18(8-6-16)22(32-24(30)27-25(2,3)4)23(29)26-20-11-9-17(10-12-20)19-13-14-31-21(28)15-19/h9-12,16,18-19,21-22,28H,5-8,13-15H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | KKZFJCWRTLGFGY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate?
The IUPAC name of [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate (CID 168846544) is [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate.
What is the SMILES notation for [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate?
The canonical SMILES for [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate is CC1CCC(C(OC(=O)NC(C)(C)C)C(=O)Nc2ccc(C3CCOC(O)C3)cc2)CC1.
What is the InChIKey of [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate?
The InChIKey is KKZFJCWRTLGFGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38N2O5/c1-16-5-7-18(8-6-16)22(32-24(30)27-25(2,3)4)23(29)26-20-11-9-17(10-12-20)19-13-14-31-21(28)15-19/h9-12,16,18-19,21-22,28H,5-8,13-15H2,1-4H3,(H,26,29)(H,27,30).
What are the key properties of [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate?
[2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate has a molecular weight of 446.59 g/mol, XLogP of 4.56, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2-hydroxyoxan-4-yl)anilino]-1-(4-methylcyclohexyl)-2-oxoethyl] N-tert-butylcarbamate is sourced from PubChem (CID 168846544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).