C33H38N4O15 — CID 168846796
[4-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 168846796) has the molecular formula C33H38N4O15 and a molecular weight of 730.68 g/mol. Its IUPAC name is [4-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 168846796 |
| Molecular Formula | C33H38N4O15 |
| Molecular Weight | 730.68 g/mol |
| Exact Mass | 730.23 |
| IUPAC Name | [4-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | NCCOCCOCCOCCn1cc(COC2c3c(O)cc(O)cc3OC(c3cc(O)c(O)c(O)c3)C2OC(=O)c2cc(O)c(O)c(O)c2)nn1 |
| InChI | InChI=1S/C33H38N4O15/c34-1-3-47-5-7-49-8-6-48-4-2-37-15-19(35-36-37)16-50-31-27-21(39)13-20(38)14-26(27)51-30(17-9-22(40)28(44)23(41)10-17)32(31)52-33(46)18-11-24(42)29(45)25(43)12-18/h9-15,30-32,38-45H,1-8,16,34H2 |
| InChIKey | MUIHSXNTMAEQJT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 291.02 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.68 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|