C34H39FN4O13 — CID 168846799
[4-[2-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-1-yl]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-5-hydroxybenzoate (PubChem CID 168846799) has the molecular formula C34H39FN4O13 and a molecular weight of 730.70 g/mol. Its IUPAC name is [4-[2-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-1-yl]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-5-hydroxybenzoate.
| Compound Name | [4-[2-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-1-yl]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-5-hydroxybenzoate |
|---|---|
| PubChem CID | 168846799 |
| Molecular Formula | C34H39FN4O13 |
| Molecular Weight | 730.70 g/mol |
| Exact Mass | 730.25 |
| IUPAC Name | [4-[2-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]triazol-1-yl]ethoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-5-hydroxybenzoate |
| SMILES | NCCOCCOCCOCCc1cn(CCOC2c3c(O)cc(O)cc3OC(c3cc(O)c(O)c(O)c3)C2OC(=O)c2cc(O)cc(F)c2)nn1 |
| InChI | InChI=1S/C34H39FN4O13/c35-21-11-20(12-23(40)15-21)34(46)52-33-31(19-13-26(43)30(45)27(44)14-19)51-28-17-24(41)16-25(42)29(28)32(33)50-6-3-39-18-22(37-38-39)1-4-47-7-9-49-10-8-48-5-2-36/h11-18,31-33,40-45H,1-10,36H2 |
| InChIKey | ZMAKNJXBPOZBJE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 250.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|